C9H13N5 — CID 116947494
hydrazinyl-(2-methyl-3H-benzimidazol-5-yl)methanamine (PubChem CID 116947494) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is hydrazinyl-(2-methyl-3H-benzimidazol-5-yl)methanamine.
| Compound Name | hydrazinyl-(2-methyl-3H-benzimidazol-5-yl)methanamine |
|---|---|
| PubChem CID | 116947494 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | hydrazinyl-(2-methyl-3H-benzimidazol-5-yl)methanamine |
| SMILES | Cc1nc2ccc(C(N)NN)cc2[nH]1 |
| InChI | InChI=1S/C9H13N5/c1-5-12-7-3-2-6(9(10)14-11)4-8(7)13-5/h2-4,9,14H,10-11H2,1H3,(H,12,13) |
| InChIKey | MZQHDPCBXPDIBU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|