C12H17N5O — CID 116849707
3-amino-N'-methyl-3-(2-methyl-3H-benzimidazol-5-yl)propanehydrazide (PubChem CID 116849707) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-amino-N'-methyl-3-(2-methyl-3H-benzimidazol-5-yl)propanehydrazide.
| Compound Name | 3-amino-N'-methyl-3-(2-methyl-3H-benzimidazol-5-yl)propanehydrazide |
|---|---|
| PubChem CID | 116849707 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-amino-N'-methyl-3-(2-methyl-3H-benzimidazol-5-yl)propanehydrazide |
| SMILES | CNNC(=O)CC(N)c1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C12H17N5O/c1-7-15-10-4-3-8(5-11(10)16-7)9(13)6-12(18)17-14-2/h3-5,9,14H,6,13H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KDGBTKWVOWAVSG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|