C13H16N2O3 — CID 115219748
3-methyl-4-[(2-methyl-1,3-benzoxazol-5-yl)amino]butanoic acid (PubChem CID 115219748) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-methyl-4-[(2-methyl-1,3-benzoxazol-5-yl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(2-methyl-1,3-benzoxazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 115219748 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-methyl-4-[(2-methyl-1,3-benzoxazol-5-yl)amino]butanoic acid |
| SMILES | Cc1nc2cc(NCC(C)CC(=O)O)ccc2o1 |
| InChI | InChI=1S/C13H16N2O3/c1-8(5-13(16)17)7-14-10-3-4-12-11(6-10)15-9(2)18-12/h3-4,6,8,14H,5,7H2,1-2H3,(H,16,17) |
| InChIKey | UYCFEFWTOABPCQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |