C12H16N2O — CID 28675901
2-methyl-N-(2-methylpropyl)-1,3-benzoxazol-5-amine (PubChem CID 28675901) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 28675901 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(NCC(C)C)ccc2o1 |
| InChI | InChI=1S/C12H16N2O/c1-8(2)7-13-10-4-5-12-11(6-10)14-9(3)15-12/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | VOGADYIVDQIQFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |