C11H15N3O2 — CID 115120319
2-amino-3-[(2-methyl-1,3-benzoxazol-6-yl)amino]propan-1-ol (PubChem CID 115120319) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-3-[(2-methyl-1,3-benzoxazol-6-yl)amino]propan-1-ol.
| Compound Name | 2-amino-3-[(2-methyl-1,3-benzoxazol-6-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 115120319 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-amino-3-[(2-methyl-1,3-benzoxazol-6-yl)amino]propan-1-ol |
| SMILES | Cc1nc2ccc(NCC(N)CO)cc2o1 |
| InChI | InChI=1S/C11H15N3O2/c1-7-14-10-3-2-9(4-11(10)16-7)13-5-8(12)6-15/h2-4,8,13,15H,5-6,12H2,1H3 |
| InChIKey | RWUXENSMALFFFM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |