C11H15N3O — CID 115197129
N'-(2-methyl-1,3-benzoxazol-6-yl)propane-1,3-diamine (PubChem CID 115197129) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N'-(2-methyl-1,3-benzoxazol-6-yl)propane-1,3-diamine.
| Compound Name | N'-(2-methyl-1,3-benzoxazol-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115197129 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N'-(2-methyl-1,3-benzoxazol-6-yl)propane-1,3-diamine |
| SMILES | Cc1nc2ccc(NCCCN)cc2o1 |
| InChI | InChI=1S/C11H15N3O/c1-8-14-10-4-3-9(7-11(10)15-8)13-6-2-5-12/h3-4,7,13H,2,5-6,12H2,1H3 |
| InChIKey | SJNWFLDNFSJQHG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|