C16H17NO3 — CID 171882248
4-amino-1-dibenzofuran-2-ylbutane-1,2-diol (PubChem CID 171882248) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-amino-1-dibenzofuran-2-ylbutane-1,2-diol.
| Compound Name | 4-amino-1-dibenzofuran-2-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 171882248 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-amino-1-dibenzofuran-2-ylbutane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C16H17NO3/c17-8-7-13(18)16(19)10-5-6-15-12(9-10)11-3-1-2-4-14(11)20-15/h1-6,9,13,16,18-19H,7-8,17H2 |
| InChIKey | KSKJIMZKZRMFFT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |