C15H22N2O — CID 59066339
5,6-ditert-butyl-1,2-benzoxazol-3-amine (PubChem CID 59066339) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5,6-ditert-butyl-1,2-benzoxazol-3-amine.
| Compound Name | 5,6-ditert-butyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 59066339 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5,6-ditert-butyl-1,2-benzoxazol-3-amine |
| SMILES | CC(C)(C)c1cc2onc(N)c2cc1C(C)(C)C |
| InChI | InChI=1S/C15H22N2O/c1-14(2,3)10-7-9-12(18-17-13(9)16)8-11(10)15(4,5)6/h7-8H,1-6H3,(H2,16,17) |
| InChIKey | INUQCRAUCMLGBJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |