About 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane
1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane (PubChem CID 153376440) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane.
Molecular Properties
| Compound Name | 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane |
| PubChem CID | 153376440 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane |
| SMILES | CCC(OC)OC.CCCC(=O)c1ccc2c(N)noc2c1 |
| InChI | InChI=1S/C11H12N2O2.C5H12O2/c1-2-3-9(14)7-4-5-8-10(6-7)15-13-11(8)12;1-4-5(6-2)7-3/h4-6H,2-3H2,1H3,(H2,12,13);5H,4H2,1-3H3 |
| InChIKey | ZDZIIKZAMYMQFZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane?
The IUPAC name of 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane (CID 153376440) is 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane.
What is the SMILES notation for 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane?
The canonical SMILES for 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane is CCC(OC)OC.CCCC(=O)c1ccc2c(N)noc2c1.
What is the InChIKey of 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane?
The InChIKey is ZDZIIKZAMYMQFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2.C5H12O2/c1-2-3-9(14)7-4-5-8-10(6-7)15-13-11(8)12;1-4-5(6-2)7-3/h4-6H,2-3H2,1H3,(H2,12,13);5H,4H2,1-3H3.
What are the key properties of 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane?
1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane has a molecular weight of 308.38 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-1,2-benzoxazol-6-yl)butan-1-one;1,1-dimethoxypropane is sourced from PubChem (CID 153376440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).