C8H8BNO3 — CID 90733121
(3-methyl-1,2-benzoxazol-5-yl)boronic acid (PubChem CID 90733121) has the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. Its IUPAC name is (3-methyl-1,2-benzoxazol-5-yl)boronic acid.
| Compound Name | (3-methyl-1,2-benzoxazol-5-yl)boronic acid |
|---|---|
| PubChem CID | 90733121 |
| Molecular Formula | C8H8BNO3 |
| Molecular Weight | 176.97 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3-methyl-1,2-benzoxazol-5-yl)boronic acid |
| SMILES | Cc1noc2ccc(B(O)O)cc12 |
| InChI | InChI=1S/C8H8BNO3/c1-5-7-4-6(9(11)12)2-3-8(7)13-10-5/h2-4,11-12H,1H3 |
| InChIKey | NNVYLRGJWAXKQN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.97 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|