benzo[e][1]benzofuran-8-ylboronic acid

C12H9BO3 — CID 166059866

IUPACbenzo[e][1]benzofuran-8-ylboronic acid
SMILESOB(O)c1ccc2ccc3occc3c2c1
InChIInChI=1S/C12H9BO3/c14-13(15)9-3-1-8-2-4-12-10(5-6-16-12)11(8)7-9/h1-7,14-15H
InChIKeySFJSUEHAELRLNM-UHFFFAOYSA-N
MW212.01 g/mol
LogP1.27
Rot. Bonds1

About benzo[e][1]benzofuran-8-ylboronic acid

benzo[e][1]benzofuran-8-ylboronic acid (PubChem CID 166059866) has the molecular formula C12H9BO3 and a molecular weight of 212.01 g/mol. Its IUPAC name is benzo[e][1]benzofuran-8-ylboronic acid.

Molecular Properties

Compound Namebenzo[e][1]benzofuran-8-ylboronic acid
PubChem CID166059866
Molecular FormulaC12H9BO3
Molecular Weight212.01 g/mol
Exact Mass212.06
IUPAC Namebenzo[e][1]benzofuran-8-ylboronic acid
SMILESOB(O)c1ccc2ccc3occc3c2c1
InChIInChI=1S/C12H9BO3/c14-13(15)9-3-1-8-2-4-12-10(5-6-16-12)11(8)7-9/h1-7,14-15H
InChIKeySFJSUEHAELRLNM-UHFFFAOYSA-N
XLogP1.27
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.01
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze benzo[e][1]benzofuran-8-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzo[e][1]benzofuran-8-ylboronic acid?
The IUPAC name of benzo[e][1]benzofuran-8-ylboronic acid (CID 166059866) is benzo[e][1]benzofuran-8-ylboronic acid.
What is the SMILES notation for benzo[e][1]benzofuran-8-ylboronic acid?
The canonical SMILES for benzo[e][1]benzofuran-8-ylboronic acid is OB(O)c1ccc2ccc3occc3c2c1.
What is the InChIKey of benzo[e][1]benzofuran-8-ylboronic acid?
The InChIKey is SFJSUEHAELRLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BO3/c14-13(15)9-3-1-8-2-4-12-10(5-6-16-12)11(8)7-9/h1-7,14-15H.
What are the key properties of benzo[e][1]benzofuran-8-ylboronic acid?
benzo[e][1]benzofuran-8-ylboronic acid has a molecular weight of 212.01 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1]benzofuran-8-ylboronic acid is sourced from PubChem (CID 166059866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).