(8-methylnaphthalen-2-yl)boronic acid

C11H11BO2 — CID 118802367

IUPAC(8-methylnaphthalen-2-yl)boronic acid
SMILESCc1cccc2ccc(B(O)O)cc12
InChIInChI=1S/C11H11BO2/c1-8-3-2-4-9-5-6-10(12(13)14)7-11(8)9/h2-7,13-14H,1H3
InChIKeyKHHLPIYDVJIWGZ-UHFFFAOYSA-N
MW186.02 g/mol
LogP0.83
Rot. Bonds1

About (8-methylnaphthalen-2-yl)boronic acid

(8-methylnaphthalen-2-yl)boronic acid (PubChem CID 118802367) has the molecular formula C11H11BO2 and a molecular weight of 186.02 g/mol. Its IUPAC name is (8-methylnaphthalen-2-yl)boronic acid.

Molecular Properties

Compound Name(8-methylnaphthalen-2-yl)boronic acid
PubChem CID118802367
Molecular FormulaC11H11BO2
Molecular Weight186.02 g/mol
Exact Mass186.09
IUPAC Name(8-methylnaphthalen-2-yl)boronic acid
SMILESCc1cccc2ccc(B(O)O)cc12
InChIInChI=1S/C11H11BO2/c1-8-3-2-4-9-5-6-10(12(13)14)7-11(8)9/h2-7,13-14H,1H3
InChIKeyKHHLPIYDVJIWGZ-UHFFFAOYSA-N
XLogP0.83
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.02
LogP ≤ 50.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (8-methylnaphthalen-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (8-methylnaphthalen-2-yl)boronic acid?
The IUPAC name of (8-methylnaphthalen-2-yl)boronic acid (CID 118802367) is (8-methylnaphthalen-2-yl)boronic acid.
What is the SMILES notation for (8-methylnaphthalen-2-yl)boronic acid?
The canonical SMILES for (8-methylnaphthalen-2-yl)boronic acid is Cc1cccc2ccc(B(O)O)cc12.
What is the InChIKey of (8-methylnaphthalen-2-yl)boronic acid?
The InChIKey is KHHLPIYDVJIWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BO2/c1-8-3-2-4-9-5-6-10(12(13)14)7-11(8)9/h2-7,13-14H,1H3.
What are the key properties of (8-methylnaphthalen-2-yl)boronic acid?
(8-methylnaphthalen-2-yl)boronic acid has a molecular weight of 186.02 g/mol, XLogP of 0.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methylnaphthalen-2-yl)boronic acid is sourced from PubChem (CID 118802367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).