C13H15N — CID 118617152
N,N,8-trimethylnaphthalen-2-amine (PubChem CID 118617152) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N,8-trimethylnaphthalen-2-amine.
| Compound Name | N,N,8-trimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 118617152 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N,N,8-trimethylnaphthalen-2-amine |
| SMILES | Cc1cccc2ccc(N(C)C)cc12 |
| InChI | InChI=1S/C13H15N/c1-10-5-4-6-11-7-8-12(14(2)3)9-13(10)11/h4-9H,1-3H3 |
| InChIKey | FPZNNNYVVQWBMB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |