C19H16N2 — CID 23422075
N,N-dimethylbenzo[a]acridin-9-amine (PubChem CID 23422075) has the molecular formula C19H16N2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N,N-dimethylbenzo[a]acridin-9-amine.
| Compound Name | N,N-dimethylbenzo[a]acridin-9-amine |
|---|---|
| PubChem CID | 23422075 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N,N-dimethylbenzo[a]acridin-9-amine |
| SMILES | CN(C)c1ccc2cc3c(ccc4ccccc43)nc2c1 |
| InChI | InChI=1S/C19H16N2/c1-21(2)15-9-7-14-11-17-16-6-4-3-5-13(16)8-10-18(17)20-19(14)12-15/h3-12H,1-2H3 |
| InChIKey | ZZZXSTQSZIFRGS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|