About 9-azido-N,N-dimethylacridin-3-amine
9-azido-N,N-dimethylacridin-3-amine (PubChem CID 154101320) has the molecular formula C15H13N5
and a molecular weight of 263.30 g/mol. Its IUPAC name is 9-azido-N,N-dimethylacridin-3-amine.
Molecular Properties
| Compound Name | 9-azido-N,N-dimethylacridin-3-amine |
| PubChem CID | 154101320 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 9-azido-N,N-dimethylacridin-3-amine |
| SMILES | CN(C)c1ccc2c(N=[N+]=[N-])c3ccccc3nc2c1 |
| InChI | InChI=1S/C15H13N5/c1-20(2)10-7-8-12-14(9-10)17-13-6-4-3-5-11(13)15(12)18-19-16/h3-9H,1-2H3 |
| InChIKey | ZFZGWWDNZXMYIR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 64.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-azido-N,N-dimethylacridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-azido-N,N-dimethylacridin-3-amine?
The IUPAC name of 9-azido-N,N-dimethylacridin-3-amine (CID 154101320) is 9-azido-N,N-dimethylacridin-3-amine.
What is the SMILES notation for 9-azido-N,N-dimethylacridin-3-amine?
The canonical SMILES for 9-azido-N,N-dimethylacridin-3-amine is CN(C)c1ccc2c(N=[N+]=[N-])c3ccccc3nc2c1.
What is the InChIKey of 9-azido-N,N-dimethylacridin-3-amine?
The InChIKey is ZFZGWWDNZXMYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5/c1-20(2)10-7-8-12-14(9-10)17-13-6-4-3-5-11(13)15(12)18-19-16/h3-9H,1-2H3.
What are the key properties of 9-azido-N,N-dimethylacridin-3-amine?
9-azido-N,N-dimethylacridin-3-amine has a molecular weight of 263.30 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-azido-N,N-dimethylacridin-3-amine is sourced from PubChem (CID 154101320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).