About 4-azido-N,N-dimethylaniline
4-azido-N,N-dimethylaniline (PubChem CID 584035) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 4-azido-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-azido-N,N-dimethylaniline |
| PubChem CID | 584035 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4-azido-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C8H10N4/c1-12(2)8-5-3-7(4-6-8)10-11-9/h3-6H,1-2H3 |
| InChIKey | BKQJWJKRVJLLFK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-N,N-dimethylaniline?
The IUPAC name of 4-azido-N,N-dimethylaniline (CID 584035) is 4-azido-N,N-dimethylaniline.
What is the SMILES notation for 4-azido-N,N-dimethylaniline?
The canonical SMILES for 4-azido-N,N-dimethylaniline is CN(C)c1ccc(N=[N+]=[N-])cc1.
What is the InChIKey of 4-azido-N,N-dimethylaniline?
The InChIKey is BKQJWJKRVJLLFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-12(2)8-5-3-7(4-6-8)10-11-9/h3-6H,1-2H3.
What are the key properties of 4-azido-N,N-dimethylaniline?
4-azido-N,N-dimethylaniline has a molecular weight of 162.20 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-N,N-dimethylaniline is sourced from PubChem (CID 584035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).