C10H14N4 — CID 104853510
4-[(1R)-1-azidoethyl]-N,N-dimethylaniline (PubChem CID 104853510) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-[(1R)-1-azidoethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1R)-1-azidoethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 104853510 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-[(1R)-1-azidoethyl]-N,N-dimethylaniline |
| SMILES | C[C@@H](N=[N+]=[N-])c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H14N4/c1-8(12-13-11)9-4-6-10(7-5-9)14(2)3/h4-8H,1-3H3/t8-/m1/s1 |
| InChIKey | VVIPEQXZDZGGJA-MRVPVSSYSA-N |
| XLogP | 3.12 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|