C20H26N2-2 — CID 101124306
4-[3-[4-(dimethylamino)phenyl]butan-2-yl]-N,N-dimethylaniline (PubChem CID 101124306) has the molecular formula C20H26N2-2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-[3-[4-(dimethylamino)phenyl]butan-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[4-(dimethylamino)phenyl]butan-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101124306 |
| Molecular Formula | C20H26N2-2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-[3-[4-(dimethylamino)phenyl]butan-2-yl]-N,N-dimethylaniline |
| SMILES | [CH2-]C(c1ccc(N(C)C)cc1)C([CH2-])c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H26N2/c1-15(17-7-11-19(12-8-17)21(3)4)16(2)18-9-13-20(14-10-18)22(5)6/h7-16H,1-2H2,3-6H3/q-2 |
| InChIKey | YDJYMTUCHCGINJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|