C14H22IN — CID 11078065
4-(1-iodohexan-2-yl)-N,N-dimethylaniline (PubChem CID 11078065) has the molecular formula C14H22IN and a molecular weight of 331.24 g/mol. Its IUPAC name is 4-(1-iodohexan-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(1-iodohexan-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11078065 |
| Molecular Formula | C14H22IN |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-(1-iodohexan-2-yl)-N,N-dimethylaniline |
| SMILES | CCCCC(CI)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H22IN/c1-4-5-6-13(11-15)12-7-9-14(10-8-12)16(2)3/h7-10,13H,4-6,11H2,1-3H3 |
| InChIKey | NNMVBEPLIJEQLY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|