C20H36N2 — CID 154320367
4-(1-aminododecyl)-N,N-dimethylaniline (PubChem CID 154320367) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 4-(1-aminododecyl)-N,N-dimethylaniline.
| Compound Name | 4-(1-aminododecyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154320367 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 4-(1-aminododecyl)-N,N-dimethylaniline |
| SMILES | CCCCCCCCCCCC(N)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H36N2/c1-4-5-6-7-8-9-10-11-12-13-20(21)18-14-16-19(17-15-18)22(2)3/h14-17,20H,4-13,21H2,1-3H3 |
| InChIKey | CCGYLEPCYLNRAN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|