C40H24N10 — CID 89149692
4-[2-(4-azidophenyl)ethynyl]-N-[4-[2-(4-azidophenyl)ethynyl]phenyl]-N-[4-(4-azidophenyl)phenyl]aniline (PubChem CID 89149692) has the molecular formula C40H24N10 and a molecular weight of 644.70 g/mol. Its IUPAC name is 4-[2-(4-azidophenyl)ethynyl]-N-[4-[2-(4-azidophenyl)ethynyl]phenyl]-N-[4-(4-azidophenyl)phenyl]aniline.
| Compound Name | 4-[2-(4-azidophenyl)ethynyl]-N-[4-[2-(4-azidophenyl)ethynyl]phenyl]-N-[4-(4-azidophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 89149692 |
| Molecular Formula | C40H24N10 |
| Molecular Weight | 644.70 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 4-[2-(4-azidophenyl)ethynyl]-N-[4-[2-(4-azidophenyl)ethynyl]phenyl]-N-[4-(4-azidophenyl)phenyl]aniline |
| SMILES | [N-]=[N+]=Nc1ccc(C#Cc2ccc(N(c3ccc(C#Cc4ccc(N=[N+]=[N-])cc4)cc3)c3ccc(-c4ccc(N=[N+]=[N-])cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H24N10/c41-47-44-35-17-5-29(6-18-35)1-3-31-9-23-38(24-10-31)50(40-27-15-34(16-28-40)33-13-21-37(22-14-33)46-49-43)39-25-11-32(12-26-39)4-2-30-7-19-36(20-8-30)45-48-42/h5-28H |
| InChIKey | OXJGXSFIFWKLST-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.70 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|