C13H16N2 — CID 177173619
N,N,2,4-tetramethylquinolin-7-amine (PubChem CID 177173619) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N,N,2,4-tetramethylquinolin-7-amine.
| Compound Name | N,N,2,4-tetramethylquinolin-7-amine |
|---|---|
| PubChem CID | 177173619 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N,N,2,4-tetramethylquinolin-7-amine |
| SMILES | Cc1cc(C)c2ccc(N(C)C)cc2n1 |
| InChI | InChI=1S/C13H16N2/c1-9-7-10(2)14-13-8-11(15(3)4)5-6-12(9)13/h5-8H,1-4H3 |
| InChIKey | BJSQHFYDKZMDFX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |