C18H22N4 — CID 46832728
2-N,2-N-diethyl-8-N,8-N-dimethylphenazine-2,8-diamine (PubChem CID 46832728) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-N,2-N-diethyl-8-N,8-N-dimethylphenazine-2,8-diamine.
| Compound Name | 2-N,2-N-diethyl-8-N,8-N-dimethylphenazine-2,8-diamine |
|---|---|
| PubChem CID | 46832728 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-N,2-N-diethyl-8-N,8-N-dimethylphenazine-2,8-diamine |
| SMILES | CCN(CC)c1ccc2nc3ccc(N(C)C)cc3nc2c1 |
| InChI | InChI=1S/C18H22N4/c1-5-22(6-2)14-8-10-16-18(12-14)20-17-11-13(21(3)4)7-9-15(17)19-16/h7-12H,5-6H2,1-4H3 |
| InChIKey | QPYYXIYGTFJRTO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|