C12H17N5 — CID 44531790
6-N,6-N-diethylquinazoline-2,4,6-triamine (PubChem CID 44531790) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-N,6-N-diethylquinazoline-2,4,6-triamine.
| Compound Name | 6-N,6-N-diethylquinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 44531790 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 6-N,6-N-diethylquinazoline-2,4,6-triamine |
| SMILES | CCN(CC)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C12H17N5/c1-3-17(4-2)8-5-6-10-9(7-8)11(13)16-12(14)15-10/h5-7H,3-4H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | OFRJUJRMWYMLFC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |