C14H13N5OS — CID 101077538
N-(2,4-diaminoquinazolin-6-yl)-N-(thiophen-2-ylmethyl)formamide (PubChem CID 101077538) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(2,4-diaminoquinazolin-6-yl)-N-(thiophen-2-ylmethyl)formamide.
| Compound Name | N-(2,4-diaminoquinazolin-6-yl)-N-(thiophen-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 101077538 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(2,4-diaminoquinazolin-6-yl)-N-(thiophen-2-ylmethyl)formamide |
| SMILES | Nc1nc(N)c2cc(N(C=O)Cc3cccs3)ccc2n1 |
| InChI | InChI=1S/C14H13N5OS/c15-13-11-6-9(3-4-12(11)17-14(16)18-13)19(8-20)7-10-2-1-5-21-10/h1-6,8H,7H2,(H4,15,16,17,18) |
| InChIKey | NSDNZZNVNLXLOW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|