C23H21N7O3S — CID 87779068
N-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-N-(thiophen-2-ylmethyl)formamide (PubChem CID 87779068) has the molecular formula C23H21N7O3S and a molecular weight of 475.53 g/mol. Its IUPAC name is N-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-N-(thiophen-2-ylmethyl)formamide.
| Compound Name | N-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-N-(thiophen-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 87779068 |
| Molecular Formula | C23H21N7O3S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-N-(thiophen-2-ylmethyl)formamide |
| SMILES | O=CN(Cc1cccs1)c1ccc(-c2ccnc(NCCNc3ccc([N+](=O)[O-])cn3)n2)cc1 |
| InChI | InChI=1S/C23H21N7O3S/c31-16-29(15-20-2-1-13-34-20)18-5-3-17(4-6-18)21-9-10-25-23(28-21)26-12-11-24-22-8-7-19(14-27-22)30(32)33/h1-10,13-14,16H,11-12,15H2,(H,24,27)(H,25,26,28) |
| InChIKey | GMZPRNUMZIMIRN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|