C17H17N7O4S — CID 91542721
N-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzenesulfonamide (PubChem CID 91542721) has the molecular formula C17H17N7O4S and a molecular weight of 415.44 g/mol. Its IUPAC name is N-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | N-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91542721 |
| Molecular Formula | C17H17N7O4S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2nccc(NS(=O)(=O)c3ccccc3)n2)nc1 |
| InChI | InChI=1S/C17H17N7O4S/c25-24(26)13-6-7-15(21-12-13)18-10-11-20-17-19-9-8-16(22-17)23-29(27,28)14-4-2-1-3-5-14/h1-9,12H,10-11H2,(H,18,21)(H2,19,20,22,23) |
| InChIKey | WCZSGGOVWOWLFV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|