C24H24N6O4S — CID 175567101
N-[2-[1-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide (PubChem CID 175567101) has the molecular formula C24H24N6O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is N-[2-[1-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[1-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 175567101 |
| Molecular Formula | C24H24N6O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[2-[1-(1-amino-4-phenylcyclohexa-2,4-dien-1-yl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
| SMILES | CC(Nc1nccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)n1)C1(N)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C24H24N6O4S/c1-17(24(25)14-11-19(12-15-24)18-5-3-2-4-6-18)27-23-26-16-13-22(28-23)29-35(33,34)21-9-7-20(8-10-21)30(31)32/h2-14,16-17H,15,25H2,1H3,(H2,26,27,28,29) |
| InChIKey | FOBURNWXVCQURM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|