C25H23N5O5S — CID 175567096
N-[2-[1-(3-methoxy-4-phenylphenyl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide (PubChem CID 175567096) has the molecular formula C25H23N5O5S and a molecular weight of 505.56 g/mol. Its IUPAC name is N-[2-[1-(3-methoxy-4-phenylphenyl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[1-(3-methoxy-4-phenylphenyl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 175567096 |
| Molecular Formula | C25H23N5O5S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-[2-[1-(3-methoxy-4-phenylphenyl)ethylamino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
| SMILES | COc1cc(C(C)Nc2nccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)n2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C25H23N5O5S/c1-17(19-8-13-22(23(16-19)35-2)18-6-4-3-5-7-18)27-25-26-15-14-24(28-25)29-36(33,34)21-11-9-20(10-12-21)30(31)32/h3-17H,1-2H3,(H2,26,27,28,29) |
| InChIKey | UFTSJRQCYJPJFE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|