C31H31N9O10S2 — CID 5022544
N-(2,6-dimethoxypyrimidin-4-yl)-4-[[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-(4-nitrophenyl)methyl]amino]benzenesulfonamide (PubChem CID 5022544) has the molecular formula C31H31N9O10S2 and a molecular weight of 753.78 g/mol. Its IUPAC name is N-(2,6-dimethoxypyrimidin-4-yl)-4-[[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-(4-nitrophenyl)methyl]amino]benzenesulfonamide.
| Compound Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-[[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-(4-nitrophenyl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 5022544 |
| Molecular Formula | C31H31N9O10S2 |
| Molecular Weight | 753.78 g/mol |
| Exact Mass | 753.16 |
| IUPAC Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-[[[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-(4-nitrophenyl)methyl]amino]benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(Nc3ccc(S(=O)(=O)Nc4cc(OC)nc(OC)n4)cc3)c3ccc([N+](=O)[O-])cc3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C31H31N9O10S2/c1-47-27-17-25(34-30(36-27)49-3)38-51(43,44)23-13-7-20(8-14-23)32-29(19-5-11-22(12-6-19)40(41)42)33-21-9-15-24(16-10-21)52(45,46)39-26-18-28(48-2)37-31(35-26)50-4/h5-18,29,32-33H,1-4H3,(H,34,36,38)(H,35,37,39) |
| InChIKey | QIRYVMQEPCWROJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 248.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|