C23H20N4O6S — CID 58398247
N-(2,6-dimethoxypyrimidin-4-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonamide (PubChem CID 58398247) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is N-(2,6-dimethoxypyrimidin-4-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonamide.
| Compound Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58398247 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | N-(2,6-dimethoxypyrimidin-4-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC3=C(C)C(=O)c4ccccc4C3=O)cc2)nc(OC)n1 |
| InChI | InChI=1S/C23H20N4O6S/c1-13-20(22(29)17-7-5-4-6-16(17)21(13)28)24-14-8-10-15(11-9-14)34(30,31)27-18-12-19(32-2)26-23(25-18)33-3/h4-12,24H,1-3H3,(H,25,26,27) |
| InChIKey | PGNLECWIICSWTH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|