C21H14N2O7S — CID 3127937
N-(2-methoxy-4-nitrophenyl)-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 3127937) has the molecular formula C21H14N2O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-9,10-dioxoanthracene-2-sulfonamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-9,10-dioxoanthracene-2-sulfonamide |
|---|---|
| PubChem CID | 3127937 |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H14N2O7S/c1-30-19-10-12(23(26)27)6-9-18(19)22-31(28,29)13-7-8-16-17(11-13)21(25)15-5-3-2-4-14(15)20(16)24/h2-11,22H,1H3 |
| InChIKey | TXPRDAVLFFZHSQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|