C21H24N4O6S — CID 142750223
4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)benzenesulfonamide (PubChem CID 142750223) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)benzenesulfonamide.
| Compound Name | 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 142750223 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-(2,3-dimethyl-5-oxo-4-propan-2-ylpyrazol-1-yl)-N-(2-methoxy-4-nitrophenyl)benzenesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NS(=O)(=O)c1ccc(-n2c(=O)c(C(C)C)c(C)n2C)cc1 |
| InChI | InChI=1S/C21H24N4O6S/c1-13(2)20-14(3)23(4)24(21(20)26)15-6-9-17(10-7-15)32(29,30)22-18-11-8-16(25(27)28)12-19(18)31-5/h6-13,22H,1-5H3 |
| InChIKey | TXVAZZSRDPTBPV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|