C25H22FN5O5S — CID 171778701
N-[2-[[(1S)-1-[4-(4-fluoro-3-methylphenoxy)phenyl]ethyl]amino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide (PubChem CID 171778701) has the molecular formula C25H22FN5O5S and a molecular weight of 523.55 g/mol. Its IUPAC name is N-[2-[[(1S)-1-[4-(4-fluoro-3-methylphenoxy)phenyl]ethyl]amino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[(1S)-1-[4-(4-fluoro-3-methylphenoxy)phenyl]ethyl]amino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 171778701 |
| Molecular Formula | C25H22FN5O5S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[2-[[(1S)-1-[4-(4-fluoro-3-methylphenoxy)phenyl]ethyl]amino]pyrimidin-4-yl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1cc(Oc2ccc([C@H](C)Nc3nccc(NS(=O)(=O)c4ccc([N+](=O)[O-])cc4)n3)cc2)ccc1F |
| InChI | InChI=1S/C25H22FN5O5S/c1-16-15-21(9-12-23(16)26)36-20-7-3-18(4-8-20)17(2)28-25-27-14-13-24(29-25)30-37(34,35)22-10-5-19(6-11-22)31(32)33/h3-15,17H,1-2H3,(H2,27,28,29,30)/t17-/m0/s1 |
| InChIKey | FMFXXAQIFGAYHT-KRWDZBQOSA-N |
| XLogP | 5.60 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|