C16H13N3O6S — CID 2907889
N-(5-methyl-1,2-oxazol-3-yl)-4-(4-nitrophenoxy)benzenesulfonamide (PubChem CID 2907889) has the molecular formula C16H13N3O6S and a molecular weight of 375.36 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-(4-nitrophenoxy)benzenesulfonamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-(4-nitrophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 2907889 |
| Molecular Formula | C16H13N3O6S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-(4-nitrophenoxy)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2)no1 |
| InChI | InChI=1S/C16H13N3O6S/c1-11-10-16(17-25-11)18-26(22,23)15-8-6-14(7-9-15)24-13-4-2-12(3-5-13)19(20)21/h2-10H,1H3,(H,17,18) |
| InChIKey | WDHWORYYGLCBLK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|