C21H20N8O2S — CID 67564146
N'-[4-[(E)-amino-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 67564146) has the molecular formula C21H20N8O2S and a molecular weight of 448.51 g/mol. Its IUPAC name is N'-[4-[(E)-amino-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-[4-[(E)-amino-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 67564146 |
| Molecular Formula | C21H20N8O2S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N'-[4-[(E)-amino-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | N/C(=C1\NC(c2ccccc2)=CS1)c1ccnc(NCCNc2ccc([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C21H20N8O2S/c22-19(20-27-17(13-32-20)14-4-2-1-3-5-14)16-8-9-24-21(28-16)25-11-10-23-18-7-6-15(12-26-18)29(30)31/h1-9,12-13,27H,10-11,22H2,(H,23,26)(H,24,25,28)/b20-19+ |
| InChIKey | NYAYRARBQWYVIF-FMQUCBEESA-N |
| XLogP | 3.22 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|