C13H18N6O2 — CID 67561666
N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;pyridin-2-ylmethanamine (PubChem CID 67561666) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;pyridin-2-ylmethanamine.
| Compound Name | N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 67561666 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;pyridin-2-ylmethanamine |
| SMILES | NCCNc1ccc([N+](=O)[O-])cn1.NCc1ccccn1 |
| InChI | InChI=1S/C7H10N4O2.C6H8N2/c8-3-4-9-7-2-1-6(5-10-7)11(12)13;7-5-6-3-1-2-4-8-6/h1-2,5H,3-4,8H2,(H,9,10);1-4H,5,7H2 |
| InChIKey | OWJLAVYIYGIOPA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|