C9H13N5O3 — CID 39161951
N-(2-aminoethyl)-2-[(5-nitro-2-pyridinyl)amino]acetamide (PubChem CID 39161951) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[(5-nitro-2-pyridinyl)amino]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[(5-nitro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 39161951 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-(2-aminoethyl)-2-[(5-nitro-2-pyridinyl)amino]acetamide |
| SMILES | NCCNC(=O)CNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C9H13N5O3/c10-3-4-11-9(15)6-13-8-2-1-7(5-12-8)14(16)17/h1-2,5H,3-4,6,10H2,(H,11,15)(H,12,13) |
| InChIKey | BWYPSAANDZAZIH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|