C14H18N6O5S2 — CID 69038973
2-[[5-(aminomethyl)thiophen-2-yl]sulfonylamino]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 69038973) has the molecular formula C14H18N6O5S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)thiophen-2-yl]sulfonylamino]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-[[5-(aminomethyl)thiophen-2-yl]sulfonylamino]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 69038973 |
| Molecular Formula | C14H18N6O5S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-[[5-(aminomethyl)thiophen-2-yl]sulfonylamino]-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | NCc1ccc(S(=O)(=O)NCC(=O)NCCNc2ccc([N+](=O)[O-])cn2)s1 |
| InChI | InChI=1S/C14H18N6O5S2/c15-7-11-2-4-14(26-11)27(24,25)19-9-13(21)17-6-5-16-12-3-1-10(8-18-12)20(22)23/h1-4,8,19H,5-7,9,15H2,(H,16,18)(H,17,21) |
| InChIKey | HLLAEVVTFGJVBE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 169.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|