C13H20ClN5O3 — CID 10019491
2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-1-pyrrolidin-1-ylethanone;hydrochloride (PubChem CID 10019491) has the molecular formula C13H20ClN5O3 and a molecular weight of 329.79 g/mol. Its IUPAC name is 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-1-pyrrolidin-1-ylethanone;hydrochloride.
| Compound Name | 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-1-pyrrolidin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 10019491 |
| Molecular Formula | C13H20ClN5O3 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]-1-pyrrolidin-1-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CNCCNc1ccc([N+](=O)[O-])cn1)N1CCCC1 |
| InChI | InChI=1S/C13H19N5O3.ClH/c19-13(17-7-1-2-8-17)10-14-5-6-15-12-4-3-11(9-16-12)18(20)21;/h3-4,9,14H,1-2,5-8,10H2,(H,15,16);1H |
| InChIKey | NRQOMTVPGDUBOW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|