C17H27N5O4 — CID 47038402
tert-butyl 4-[3-[(5-nitro-2-pyridinyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 47038402) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is tert-butyl 4-[3-[(5-nitro-2-pyridinyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(5-nitro-2-pyridinyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 47038402 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | tert-butyl 4-[3-[(5-nitro-2-pyridinyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNc2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C17H27N5O4/c1-17(2,3)26-16(23)21-11-9-20(10-12-21)8-4-7-18-15-6-5-14(13-19-15)22(24)25/h5-6,13H,4,7-12H2,1-3H3,(H,18,19) |
| InChIKey | NHIWHQXVYCXLAF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|