C7H11ClN4O2 — CID 141044426
N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;hydrochloride (PubChem CID 141044426) has the molecular formula C7H11ClN4O2 and a molecular weight of 218.64 g/mol. Its IUPAC name is N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 141044426 |
| Molecular Formula | C7H11ClN4O2 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N'-(5-nitro-2-pyridinyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C7H10N4O2.ClH/c8-3-4-9-7-2-1-6(5-10-7)11(12)13;/h1-2,5H,3-4,8H2,(H,9,10);1H |
| InChIKey | DAAXGUYRRKLCBI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|