C12H18ClN5O3 — CID 120704609
2-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;hydrochloride (PubChem CID 120704609) has the molecular formula C12H18ClN5O3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120704609 |
| Molecular Formula | C12H18ClN5O3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCC(Nc2ccc([N+](=O)[O-])cn2)C1.Cl |
| InChI | InChI=1S/C12H17N5O3.ClH/c1-13-7-12(18)16-5-4-9(8-16)15-11-3-2-10(6-14-11)17(19)20;/h2-3,6,9,13H,4-5,7-8H2,1H3,(H,14,15);1H |
| InChIKey | JAVYHTCXNYRQGO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|