C15H21N5O4 — CID 120800868
[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone (PubChem CID 120800868) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone.
| Compound Name | [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 120800868 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(2S,5R)-5-(aminomethyl)oxolan-2-yl]-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone |
| SMILES | NC[C@H]1CC[C@@H](C(=O)N2CCC(Nc3ccc([N+](=O)[O-])cn3)C2)O1 |
| InChI | InChI=1S/C15H21N5O4/c16-7-12-2-3-13(24-12)15(21)19-6-5-10(9-19)18-14-4-1-11(8-17-14)20(22)23/h1,4,8,10,12-13H,2-3,5-7,9,16H2,(H,17,18)/t10?,12-,13+/m1/s1 |
| InChIKey | QBPOOYHUMRBOFI-SOYIIFOFSA-N |
| XLogP | 0.51 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|