C15H21N5O3 — CID 119890597
[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]-piperidin-3-ylmethanone (PubChem CID 119890597) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is [3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]-piperidin-3-ylmethanone.
| Compound Name | [3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119890597 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | [3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]-piperidin-3-ylmethanone |
| SMILES | O=C(C1CCCNC1)N1CCC(Nc2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C15H21N5O3/c21-15(11-2-1-6-16-8-11)19-7-5-12(10-19)18-14-4-3-13(9-17-14)20(22)23/h3-4,9,11-12,16H,1-2,5-8,10H2,(H,17,18) |
| InChIKey | IMOWFAPTZKIDFF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|