C14H21Cl2N5O4 — CID 119890658
morpholin-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone;dihydrochloride (PubChem CID 119890658) has the molecular formula C14H21Cl2N5O4 and a molecular weight of 394.26 g/mol. Its IUPAC name is morpholin-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone;dihydrochloride.
| Compound Name | morpholin-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119890658 |
| Molecular Formula | C14H21Cl2N5O4 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | morpholin-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CNCCO1)N1CCC(Nc2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C14H19N5O4.2ClH/c20-14(12-8-15-4-6-23-12)18-5-3-10(9-18)17-13-2-1-11(7-16-13)19(21)22;;/h1-2,7,10,12,15H,3-6,8-9H2,(H,16,17);2*1H |
| InChIKey | KTRUOXONRAMZQM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|