C18H25N5O3 — CID 119890627
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone (PubChem CID 119890627) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119890627 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CC2CCCCC2N1)N1CCC(Nc2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C18H25N5O3/c24-18(16-9-12-3-1-2-4-15(12)21-16)22-8-7-13(11-22)20-17-6-5-14(10-19-17)23(25)26/h5-6,10,12-13,15-16,21H,1-4,7-9,11H2,(H,19,20) |
| InChIKey | ISOZNECMFTXXJX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|