C20H28ClN3O4 — CID 119334475
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-nitrophenoxy)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119334475) has the molecular formula C20H28ClN3O4 and a molecular weight of 409.91 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-nitrophenoxy)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-nitrophenoxy)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119334475 |
| Molecular Formula | C20H28ClN3O4 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-nitrophenoxy)piperidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC2CCCCC2N1)N1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H27N3O4.ClH/c24-20(19-13-14-3-1-2-4-18(14)21-19)22-11-9-17(10-12-22)27-16-7-5-15(6-8-16)23(25)26;/h5-8,14,17-19,21H,1-4,9-13H2;1H |
| InChIKey | JXZSHNMGFCCTHM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|