C19H33ClN2O2 — CID 119312935
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(4-cyclopentyloxypiperidin-1-yl)methanone;hydrochloride (PubChem CID 119312935) has the molecular formula C19H33ClN2O2 and a molecular weight of 356.94 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(4-cyclopentyloxypiperidin-1-yl)methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(4-cyclopentyloxypiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119312935 |
| Molecular Formula | C19H33ClN2O2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(4-cyclopentyloxypiperidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC2CCCCC2N1)N1CCC(OC2CCCC2)CC1 |
| InChI | InChI=1S/C19H32N2O2.ClH/c22-19(18-13-14-5-1-4-8-17(14)20-18)21-11-9-16(10-12-21)23-15-6-2-3-7-15;/h14-18,20H,1-13H2;1H |
| InChIKey | WBEIGRNBXOUIKE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |