C16H28ClN3O3 — CID 119281890
1-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperazin-1-yl]-2-methoxyethanone;hydrochloride (PubChem CID 119281890) has the molecular formula C16H28ClN3O3 and a molecular weight of 345.87 g/mol. Its IUPAC name is 1-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperazin-1-yl]-2-methoxyethanone;hydrochloride.
| Compound Name | 1-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperazin-1-yl]-2-methoxyethanone;hydrochloride |
|---|---|
| PubChem CID | 119281890 |
| Molecular Formula | C16H28ClN3O3 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperazin-1-yl]-2-methoxyethanone;hydrochloride |
| SMILES | COCC(=O)N1CCN(C(=O)C2CC3CCCCC3N2)CC1.Cl |
| InChI | InChI=1S/C16H27N3O3.ClH/c1-22-11-15(20)18-6-8-19(9-7-18)16(21)14-10-12-4-2-3-5-13(12)17-14;/h12-14,17H,2-11H2,1H3;1H |
| InChIKey | GIEKXESGKHWTRH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |